C16H25N5O5S — CID 119559099
3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-3-ylethyl)propanamide (PubChem CID 119559099) has the molecular formula C16H25N5O5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-3-ylethyl)propanamide.
| Compound Name | 3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-3-ylethyl)propanamide |
|---|---|
| PubChem CID | 119559099 |
| Molecular Formula | C16H25N5O5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 3-(2-nitro-4-sulfamoylanilino)-N-(2-piperidin-3-ylethyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC(=O)NCCC2CCCNC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H25N5O5S/c17-27(25,26)13-3-4-14(15(10-13)21(23)24)19-9-6-16(22)20-8-5-12-2-1-7-18-11-12/h3-4,10,12,18-19H,1-2,5-9,11H2,(H,20,22)(H2,17,25,26) |
| InChIKey | UPYHLZXSTUMZBY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|