C12H18BrN3O2S — CID 80554293
3-bromo-4-(piperidin-3-ylmethylamino)benzenesulfonamide (PubChem CID 80554293) has the molecular formula C12H18BrN3O2S and a molecular weight of 348.27 g/mol. Its IUPAC name is 3-bromo-4-(piperidin-3-ylmethylamino)benzenesulfonamide.
| Compound Name | 3-bromo-4-(piperidin-3-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 80554293 |
| Molecular Formula | C12H18BrN3O2S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 3-bromo-4-(piperidin-3-ylmethylamino)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCC2CCCNC2)c(Br)c1 |
| InChI | InChI=1S/C12H18BrN3O2S/c13-11-6-10(19(14,17)18)3-4-12(11)16-8-9-2-1-5-15-7-9/h3-4,6,9,15-16H,1-2,5,7-8H2,(H2,14,17,18) |
| InChIKey | LZZFZFFCKXPEJX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |