C12H16BrN3O3S — CID 81125256
(3R)-N-(2-bromo-4-sulfamoylphenyl)piperidine-3-carboxamide (PubChem CID 81125256) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is (3R)-N-(2-bromo-4-sulfamoylphenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(2-bromo-4-sulfamoylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 81125256 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | (3R)-N-(2-bromo-4-sulfamoylphenyl)piperidine-3-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)[C@@H]2CCCNC2)c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3O3S/c13-10-6-9(20(14,18)19)3-4-11(10)16-12(17)8-2-1-5-15-7-8/h3-4,6,8,15H,1-2,5,7H2,(H,16,17)(H2,14,18,19)/t8-/m1/s1 |
| InChIKey | GYDKMPZBGSJESG-MRVPVSSYSA-N |
| XLogP | 1.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |