C16H25ClN4O5S — CID 119555842
3-[(4-nitrophenyl)sulfonylamino]-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride (PubChem CID 119555842) has the molecular formula C16H25ClN4O5S and a molecular weight of 420.92 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)sulfonylamino]-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride.
| Compound Name | 3-[(4-nitrophenyl)sulfonylamino]-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119555842 |
| Molecular Formula | C16H25ClN4O5S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 3-[(4-nitrophenyl)sulfonylamino]-N-(2-piperidin-3-ylethyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)NCCC1CCCNC1 |
| InChI | InChI=1S/C16H24N4O5S.ClH/c21-16(18-10-7-13-2-1-9-17-12-13)8-11-19-26(24,25)15-5-3-14(4-6-15)20(22)23;/h3-6,13,17,19H,1-2,7-12H2,(H,18,21);1H |
| InChIKey | KIDNYYATQNEQFJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|