C16H26ClN5O5S — CID 119391413
3-[(4-nitrophenyl)sulfonylamino]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride (PubChem CID 119391413) has the molecular formula C16H26ClN5O5S and a molecular weight of 435.93 g/mol. Its IUPAC name is 3-[(4-nitrophenyl)sulfonylamino]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride.
| Compound Name | 3-[(4-nitrophenyl)sulfonylamino]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119391413 |
| Molecular Formula | C16H26ClN5O5S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-[(4-nitrophenyl)sulfonylamino]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C16H25N5O5S.ClH/c22-16(18-7-1-11-20-12-9-17-10-13-20)6-8-19-27(25,26)15-4-2-14(3-5-15)21(23)24;/h2-5,17,19H,1,6-13H2,(H,18,22);1H |
| InChIKey | GDSFQGGZORJQNT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|