C17H29ClN4O3S — CID 119393763
3-[4-(methylsulfamoyl)phenyl]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride (PubChem CID 119393763) has the molecular formula C17H29ClN4O3S and a molecular weight of 404.96 g/mol. Its IUPAC name is 3-[4-(methylsulfamoyl)phenyl]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride.
| Compound Name | 3-[4-(methylsulfamoyl)phenyl]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119393763 |
| Molecular Formula | C17H29ClN4O3S |
| Molecular Weight | 404.96 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 3-[4-(methylsulfamoyl)phenyl]-N-(3-piperazin-1-ylpropyl)propanamide;hydrochloride |
| SMILES | CNS(=O)(=O)c1ccc(CCC(=O)NCCCN2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C17H28N4O3S.ClH/c1-18-25(23,24)16-6-3-15(4-7-16)5-8-17(22)20-9-2-12-21-13-10-19-11-14-21;/h3-4,6-7,18-19H,2,5,8-14H2,1H3,(H,20,22);1H |
| InChIKey | YRDRNHFVGBOBKZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.96 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|