C17H25F2N3O — CID 119392670
4-(3,4-difluorophenyl)-N-(3-piperazin-1-ylpropyl)butanamide (PubChem CID 119392670) has the molecular formula C17H25F2N3O and a molecular weight of 325.40 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-N-(3-piperazin-1-ylpropyl)butanamide.
| Compound Name | 4-(3,4-difluorophenyl)-N-(3-piperazin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 119392670 |
| Molecular Formula | C17H25F2N3O |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4-(3,4-difluorophenyl)-N-(3-piperazin-1-ylpropyl)butanamide |
| SMILES | O=C(CCCc1ccc(F)c(F)c1)NCCCN1CCNCC1 |
| InChI | InChI=1S/C17H25F2N3O/c18-15-6-5-14(13-16(15)19)3-1-4-17(23)21-7-2-10-22-11-8-20-9-12-22/h5-6,13,20H,1-4,7-12H2,(H,21,23) |
| InChIKey | WLJXUPGSNCQATF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|