C17H29N3OS — CID 119394631
4-(2,5-dimethylthiophen-3-yl)-N-(3-piperazin-1-ylpropyl)butanamide (PubChem CID 119394631) has the molecular formula C17H29N3OS and a molecular weight of 323.51 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N-(3-piperazin-1-ylpropyl)butanamide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N-(3-piperazin-1-ylpropyl)butanamide |
|---|---|
| PubChem CID | 119394631 |
| Molecular Formula | C17H29N3OS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N-(3-piperazin-1-ylpropyl)butanamide |
| SMILES | Cc1cc(CCCC(=O)NCCCN2CCNCC2)c(C)s1 |
| InChI | InChI=1S/C17H29N3OS/c1-14-13-16(15(2)22-14)5-3-6-17(21)19-7-4-10-20-11-8-18-9-12-20/h13,18H,3-12H2,1-2H3,(H,19,21) |
| InChIKey | CHTPVFPOHUYDPJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|