C17H20N4O5S2 — CID 55407564
3-(2-nitro-4-sulfamoylanilino)-N-(2-phenylsulfanylethyl)propanamide (PubChem CID 55407564) has the molecular formula C17H20N4O5S2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-(2-nitro-4-sulfamoylanilino)-N-(2-phenylsulfanylethyl)propanamide.
| Compound Name | 3-(2-nitro-4-sulfamoylanilino)-N-(2-phenylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 55407564 |
| Molecular Formula | C17H20N4O5S2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-(2-nitro-4-sulfamoylanilino)-N-(2-phenylsulfanylethyl)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC(=O)NCCSc2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H20N4O5S2/c18-28(25,26)14-6-7-15(16(12-14)21(23)24)19-9-8-17(22)20-10-11-27-13-4-2-1-3-5-13/h1-7,12,19H,8-11H2,(H,20,22)(H2,18,25,26) |
| InChIKey | YUYDNUQGOFKEJQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|