C21H27N5O6S — CID 24505188
N-(2-morpholin-4-yl-1-phenylethyl)-3-(2-nitro-4-sulfamoylanilino)propanamide (PubChem CID 24505188) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-1-phenylethyl)-3-(2-nitro-4-sulfamoylanilino)propanamide.
| Compound Name | N-(2-morpholin-4-yl-1-phenylethyl)-3-(2-nitro-4-sulfamoylanilino)propanamide |
|---|---|
| PubChem CID | 24505188 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-(2-morpholin-4-yl-1-phenylethyl)-3-(2-nitro-4-sulfamoylanilino)propanamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC(=O)NC(CN2CCOCC2)c2ccccc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H27N5O6S/c22-33(30,31)17-6-7-18(20(14-17)26(28)29)23-9-8-21(27)24-19(16-4-2-1-3-5-16)15-25-10-12-32-13-11-25/h1-7,14,19,23H,8-13,15H2,(H,24,27)(H2,22,30,31) |
| InChIKey | OIWQQIBKWDYUET-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 156.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|