C19H33Cl2N3O2 — CID 119835989
7-amino-N-(2-morpholin-4-yl-1-phenylethyl)heptanamide;dihydrochloride (PubChem CID 119835989) has the molecular formula C19H33Cl2N3O2 and a molecular weight of 406.40 g/mol. Its IUPAC name is 7-amino-N-(2-morpholin-4-yl-1-phenylethyl)heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-(2-morpholin-4-yl-1-phenylethyl)heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119835989 |
| Molecular Formula | C19H33Cl2N3O2 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 7-amino-N-(2-morpholin-4-yl-1-phenylethyl)heptanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)NC(CN1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C19H31N3O2.2ClH/c20-11-7-2-1-6-10-19(23)21-18(17-8-4-3-5-9-17)16-22-12-14-24-15-13-22;;/h3-5,8-9,18H,1-2,6-7,10-16,20H2,(H,21,23);2*1H |
| InChIKey | XHMKEYAVZFJKHI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|