C19H25FN6O9S2 — CID 87316206
4-fluoro-3-nitrobenzenesulfonamide;4-(3-morpholin-4-ylpropylamino)-3-nitrobenzenesulfonamide (PubChem CID 87316206) has the molecular formula C19H25FN6O9S2 and a molecular weight of 564.57 g/mol. Its IUPAC name is 4-fluoro-3-nitrobenzenesulfonamide;4-(3-morpholin-4-ylpropylamino)-3-nitrobenzenesulfonamide.
| Compound Name | 4-fluoro-3-nitrobenzenesulfonamide;4-(3-morpholin-4-ylpropylamino)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 87316206 |
| Molecular Formula | C19H25FN6O9S2 |
| Molecular Weight | 564.57 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 4-fluoro-3-nitrobenzenesulfonamide;4-(3-morpholin-4-ylpropylamino)-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(F)c([N+](=O)[O-])c1.NS(=O)(=O)c1ccc(NCCCN2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H20N4O5S.C6H5FN2O4S/c14-23(20,21)11-2-3-12(13(10-11)17(18)19)15-4-1-5-16-6-8-22-9-7-16;7-5-2-1-4(14(8,12)13)3-6(5)9(10)11/h2-3,10,15H,1,4-9H2,(H2,14,20,21);1-3H,(H2,8,12,13) |
| InChIKey | ZFXVXOQRARLGAL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 231.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.57 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|