C20H34N8O6S — CID 67227861
4-(3-aminopropyl)piperazin-2-one;3-nitro-4-[3-(3-oxopiperazin-1-yl)propylamino]benzenesulfonamide (PubChem CID 67227861) has the molecular formula C20H34N8O6S and a molecular weight of 514.61 g/mol. Its IUPAC name is 4-(3-aminopropyl)piperazin-2-one;3-nitro-4-[3-(3-oxopiperazin-1-yl)propylamino]benzenesulfonamide.
| Compound Name | 4-(3-aminopropyl)piperazin-2-one;3-nitro-4-[3-(3-oxopiperazin-1-yl)propylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 67227861 |
| Molecular Formula | C20H34N8O6S |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 4-(3-aminopropyl)piperazin-2-one;3-nitro-4-[3-(3-oxopiperazin-1-yl)propylamino]benzenesulfonamide |
| SMILES | NCCCN1CCNC(=O)C1.NS(=O)(=O)c1ccc(NCCCN2CCNC(=O)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H19N5O5S.C7H15N3O/c14-24(22,23)10-2-3-11(12(8-10)18(20)21)15-4-1-6-17-7-5-16-13(19)9-17;8-2-1-4-10-5-3-9-7(11)6-10/h2-3,8,15H,1,4-7,9H2,(H,16,19)(H2,14,22,23);1-6,8H2,(H,9,11) |
| InChIKey | UDYIRGISBXQDRQ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 206.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|