C13H17N3O5S — CID 133390333
4-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-3-nitrobenzenesulfonamide (PubChem CID 133390333) has the molecular formula C13H17N3O5S and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133390333 |
| Molecular Formula | C13H17N3O5S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 4-[2-(3,6-dihydro-2H-pyran-4-yl)ethylamino]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCC2=CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H17N3O5S/c14-22(19,20)11-1-2-12(13(9-11)16(17)18)15-6-3-10-4-7-21-8-5-10/h1-2,4,9,15H,3,5-8H2,(H2,14,19,20) |
| InChIKey | MRNXQPJTXAINQS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|