C15H17N3O5S — CID 133434934
4-[2-[4-(hydroxymethyl)phenyl]ethylamino]-3-nitrobenzenesulfonamide (PubChem CID 133434934) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-[2-[4-(hydroxymethyl)phenyl]ethylamino]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[4-(hydroxymethyl)phenyl]ethylamino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 133434934 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-[2-[4-(hydroxymethyl)phenyl]ethylamino]-3-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(NCCc2ccc(CO)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O5S/c16-24(22,23)13-5-6-14(15(9-13)18(20)21)17-8-7-11-1-3-12(10-19)4-2-11/h1-6,9,17,19H,7-8,10H2,(H2,16,22,23) |
| InChIKey | IFNDBEDPYOCLEQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|