C19H20N4O6S — CID 46374519
4-[2-[4-(2,6-dioxopiperidin-1-yl)-2-nitroanilino]ethyl]benzenesulfonamide (PubChem CID 46374519) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is 4-[2-[4-(2,6-dioxopiperidin-1-yl)-2-nitroanilino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[4-(2,6-dioxopiperidin-1-yl)-2-nitroanilino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46374519 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-[2-[4-(2,6-dioxopiperidin-1-yl)-2-nitroanilino]ethyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CCNc2ccc(N3C(=O)CCCC3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H20N4O6S/c20-30(28,29)15-7-4-13(5-8-15)10-11-21-16-9-6-14(12-17(16)23(26)27)22-18(24)2-1-3-19(22)25/h4-9,12,21H,1-3,10-11H2,(H2,20,28,29) |
| InChIKey | APAPUDXZGNNGNE-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 152.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|