C17H23N3O5 — CID 24761455
1-[3-nitro-4-(3-propan-2-yloxypropylamino)phenyl]piperidine-2,6-dione (PubChem CID 24761455) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 1-[3-nitro-4-(3-propan-2-yloxypropylamino)phenyl]piperidine-2,6-dione.
| Compound Name | 1-[3-nitro-4-(3-propan-2-yloxypropylamino)phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 24761455 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 1-[3-nitro-4-(3-propan-2-yloxypropylamino)phenyl]piperidine-2,6-dione |
| SMILES | CC(C)OCCCNc1ccc(N2C(=O)CCCC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N3O5/c1-12(2)25-10-4-9-18-14-8-7-13(11-15(14)20(23)24)19-16(21)5-3-6-17(19)22/h7-8,11-12,18H,3-6,9-10H2,1-2H3 |
| InChIKey | ZFLZPIWGABSZHR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|