C26H28N4O7S — CID 67423419
3-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-phenoxybenzamide (PubChem CID 67423419) has the molecular formula C26H28N4O7S and a molecular weight of 540.60 g/mol. Its IUPAC name is 3-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-phenoxybenzamide.
| Compound Name | 3-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-phenoxybenzamide |
|---|---|
| PubChem CID | 67423419 |
| Molecular Formula | C26H28N4O7S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | 3-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-2-phenoxybenzamide |
| SMILES | NC(=O)c1cccc(S(=O)(=O)c2ccc(NCCCN3CCOCC3)c([N+](=O)[O-])c2)c1Oc1ccccc1 |
| InChI | InChI=1S/C26H28N4O7S/c27-26(31)21-8-4-9-24(25(21)37-19-6-2-1-3-7-19)38(34,35)20-10-11-22(23(18-20)30(32)33)28-12-5-13-29-14-16-36-17-15-29/h1-4,6-11,18,28H,5,12-17H2,(H2,27,31) |
| InChIKey | QBPIRIKBDIUEMG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|