C26H30N4O7S — CID 67423417
6-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-6-phenoxycyclohexa-2,4-diene-1-carboxamide (PubChem CID 67423417) has the molecular formula C26H30N4O7S and a molecular weight of 542.61 g/mol. Its IUPAC name is 6-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-6-phenoxycyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-6-phenoxycyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 67423417 |
| Molecular Formula | C26H30N4O7S |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 6-[4-(3-morpholin-4-ylpropylamino)-3-nitrophenyl]sulfonyl-6-phenoxycyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC=CC1(Oc1ccccc1)S(=O)(=O)c1ccc(NCCCN2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H30N4O7S/c27-25(31)22-9-4-5-12-26(22,37-20-7-2-1-3-8-20)38(34,35)21-10-11-23(24(19-21)30(32)33)28-13-6-14-29-15-17-36-18-16-29/h1-5,7-12,19,22,28H,6,13-18H2,(H2,27,31) |
| InChIKey | ZQQJSKPDMPSZHZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|