C24H23N5O7S — CID 67194065
6-[3-nitro-4-[[(3R)-oxolan-3-yl]amino]phenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 67194065) has the molecular formula C24H23N5O7S and a molecular weight of 525.54 g/mol. Its IUPAC name is 6-[3-nitro-4-[[(3R)-oxolan-3-yl]amino]phenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[3-nitro-4-[[(3R)-oxolan-3-yl]amino]phenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 67194065 |
| Molecular Formula | C24H23N5O7S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 6-[3-nitro-4-[[(3R)-oxolan-3-yl]amino]phenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | NC(=O)C1C=CC=CC1(Oc1cnc2[nH]ccc2c1)S(=O)(=O)c1ccc(N[C@@H]2CCOC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H23N5O7S/c25-22(30)19-3-1-2-8-24(19,36-17-11-15-6-9-26-23(15)27-13-17)37(33,34)18-4-5-20(21(12-18)29(31)32)28-16-7-10-35-14-16/h1-6,8-9,11-13,16,19,28H,7,10,14H2,(H2,25,30)(H,26,27)/t16-,19?,24?/m1/s1 |
| InChIKey | ZBKYOXDWBCHUQE-GIRCCAPASA-N |
| XLogP | 2.45 |
| TPSA | 179.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|