C27H29N5O8S — CID 67514585
6-[4-[(4-ethylmorpholin-3-yl)methoxy]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide (PubChem CID 67514585) has the molecular formula C27H29N5O8S and a molecular weight of 583.62 g/mol. Its IUPAC name is 6-[4-[(4-ethylmorpholin-3-yl)methoxy]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide.
| Compound Name | 6-[4-[(4-ethylmorpholin-3-yl)methoxy]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 67514585 |
| Molecular Formula | C27H29N5O8S |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 6-[4-[(4-ethylmorpholin-3-yl)methoxy]-3-nitrophenyl]sulfonyl-6-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)cyclohexa-2,4-diene-1-carboxamide |
| SMILES | CCN1CCOCC1COc1ccc(S(=O)(=O)C2(Oc3cnc4[nH]ccc4c3)C=CC=CC2C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H29N5O8S/c1-2-31-11-12-38-16-19(31)17-39-24-7-6-21(14-23(24)32(34)35)41(36,37)27(9-4-3-5-22(27)25(28)33)40-20-13-18-8-10-29-26(18)30-15-20/h3-10,13-15,19,22H,2,11-12,16-17H2,1H3,(H2,28,33)(H,29,30) |
| InChIKey | CPNOPLJVWWOZHU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 179.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|