C28H26N4O9S — CID 151027712
N-[4-[[(1R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methoxy]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 151027712) has the molecular formula C28H26N4O9S and a molecular weight of 594.60 g/mol. Its IUPAC name is N-[4-[[(1R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methoxy]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[4-[[(1R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methoxy]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 151027712 |
| Molecular Formula | C28H26N4O9S |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | N-[4-[[(1R,4R,5S,6R)-5,6-dihydroxy-2-bicyclo[2.2.1]heptanyl]methoxy]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(OCC2C[C@@H]3C[C@H]2[C@@H](O)[C@H]3O)c([N+](=O)[O-])c1)c1ccccc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C28H26N4O9S/c33-25-16-9-17(21(11-16)26(25)34)14-40-24-6-5-19(12-22(24)32(36)37)42(38,39)31-28(35)20-3-1-2-4-23(20)41-18-10-15-7-8-29-27(15)30-13-18/h1-8,10,12-13,16-17,21,25-26,33-34H,9,11,14H2,(H,29,30)(H,31,35)/t16-,17?,21-,25+,26-/m1/s1 |
| InChIKey | LZKCHWJQLGQROA-ZEZCUASCSA-N |
| XLogP | 3.14 |
| TPSA | 193.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|