C26H24FN5O7S — CID 175740365
N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide (PubChem CID 175740365) has the molecular formula C26H24FN5O7S and a molecular weight of 569.57 g/mol. Its IUPAC name is N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide.
| Compound Name | N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
|---|---|
| PubChem CID | 175740365 |
| Molecular Formula | C26H24FN5O7S |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC2(F)CCOCC2)c([N+](=O)[O-])c1)c1ccccc1Oc1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C26H24FN5O7S/c27-26(8-11-38-12-9-26)16-30-21-6-5-19(14-22(21)32(34)35)40(36,37)31-25(33)20-3-1-2-4-23(20)39-18-13-17-7-10-28-24(17)29-15-18/h1-7,10,13-15,30H,8-9,11-12,16H2,(H,28,29)(H,31,33) |
| InChIKey | OGHBLTHZOFBIFM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 165.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|