C28H25FN6O8S — CID 175883700
N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(12-oxo-13-oxa-2,4,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraen-10-yl)benzamide (PubChem CID 175883700) has the molecular formula C28H25FN6O8S and a molecular weight of 624.61 g/mol. Its IUPAC name is N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(12-oxo-13-oxa-2,4,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraen-10-yl)benzamide.
| Compound Name | N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(12-oxo-13-oxa-2,4,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraen-10-yl)benzamide |
|---|---|
| PubChem CID | 175883700 |
| Molecular Formula | C28H25FN6O8S |
| Molecular Weight | 624.61 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonyl-2-(12-oxo-13-oxa-2,4,10-triazatricyclo[7.4.0.03,7]trideca-1(9),2,5,7-tetraen-10-yl)benzamide |
| SMILES | O=C1CN(c2ccccc2C(=O)NS(=O)(=O)c2ccc(NCC3(F)CCOCC3)c([N+](=O)[O-])c2)c2cc3cc[nH]c3nc2O1 |
| InChI | InChI=1S/C28H25FN6O8S/c29-28(8-11-42-12-9-28)16-31-20-6-5-18(14-22(20)35(38)39)44(40,41)33-26(37)19-3-1-2-4-21(19)34-15-24(36)43-27-23(34)13-17-7-10-30-25(17)32-27/h1-7,10,13-14,31H,8-9,11-12,15-16H2,(H,30,32)(H,33,37) |
| InChIKey | MVTUHUMKLSXZQK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 185.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|