C19H21ClFN3O6S — CID 175757479
N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonylbenzamide;hydrochloride (PubChem CID 175757479) has the molecular formula C19H21ClFN3O6S and a molecular weight of 473.91 g/mol. Its IUPAC name is N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonylbenzamide;hydrochloride.
| Compound Name | N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 175757479 |
| Molecular Formula | C19H21ClFN3O6S |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | N-[4-[(4-fluorooxan-4-yl)methylamino]-3-nitrophenyl]sulfonylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NS(=O)(=O)c1ccc(NCC2(F)CCOCC2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C19H20FN3O6S.ClH/c20-19(8-10-29-11-9-19)13-21-16-7-6-15(12-17(16)23(25)26)30(27,28)22-18(24)14-4-2-1-3-5-14;/h1-7,12,21H,8-11,13H2,(H,22,24);1H |
| InChIKey | GTBCACQFVBGQLP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|