C21H25N3O9S — CID 175829830
N-[3-nitro-4-[(3,4,5-trihydroxy-6,6-dimethyloxan-2-yl)methylamino]phenyl]sulfonylbenzamide (PubChem CID 175829830) has the molecular formula C21H25N3O9S and a molecular weight of 495.51 g/mol. Its IUPAC name is N-[3-nitro-4-[(3,4,5-trihydroxy-6,6-dimethyloxan-2-yl)methylamino]phenyl]sulfonylbenzamide.
| Compound Name | N-[3-nitro-4-[(3,4,5-trihydroxy-6,6-dimethyloxan-2-yl)methylamino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 175829830 |
| Molecular Formula | C21H25N3O9S |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | N-[3-nitro-4-[(3,4,5-trihydroxy-6,6-dimethyloxan-2-yl)methylamino]phenyl]sulfonylbenzamide |
| SMILES | CC1(C)OC(CNc2ccc(S(=O)(=O)NC(=O)c3ccccc3)cc2[N+](=O)[O-])C(O)C(O)C1O |
| InChI | InChI=1S/C21H25N3O9S/c1-21(2)19(27)18(26)17(25)16(33-21)11-22-14-9-8-13(10-15(14)24(29)30)34(31,32)23-20(28)12-6-4-3-5-7-12/h3-10,16-19,22,25-27H,11H2,1-2H3,(H,23,28) |
| InChIKey | CIDSTWHIXWVCEP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 188.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|