C28H23N5O8S2 — CID 53234844
4-[(4-nitrobenzoyl)amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 53234844) has the molecular formula C28H23N5O8S2 and a molecular weight of 621.65 g/mol. Its IUPAC name is 4-[(4-nitrobenzoyl)amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[(4-nitrobenzoyl)amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 53234844 |
| Molecular Formula | C28H23N5O8S2 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.10 |
| IUPAC Name | 4-[(4-nitrobenzoyl)amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=C(Nc1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H23N5O8S2/c34-27(19-8-12-22(13-9-19)32(36)37)30-21-10-6-20(7-11-21)28(35)31-43(40,41)24-14-15-25(26(18-24)33(38)39)29-16-17-42-23-4-2-1-3-5-23/h1-15,18,29H,16-17H2,(H,30,34)(H,31,35) |
| InChIKey | GWVZFUNWPAOEPL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|