C30H28N4O6S2 — CID 134153984
N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-(3-phenylpropanoylamino)benzamide (PubChem CID 134153984) has the molecular formula C30H28N4O6S2 and a molecular weight of 604.71 g/mol. Its IUPAC name is N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-(3-phenylpropanoylamino)benzamide.
| Compound Name | N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-(3-phenylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 134153984 |
| Molecular Formula | C30H28N4O6S2 |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-4-(3-phenylpropanoylamino)benzamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C30H28N4O6S2/c35-29(18-11-22-7-3-1-4-8-22)32-24-14-12-23(13-15-24)30(36)33-42(39,40)26-16-17-27(28(21-26)34(37)38)31-19-20-41-25-9-5-2-6-10-25/h1-10,12-17,21,31H,11,18-20H2,(H,32,35)(H,33,36) |
| InChIKey | NNNSNOXNCDVQGR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|