C28H33N5O6S2 — CID 141238340
4-[[(2S)-2-acetamido-3-methylbutyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 141238340) has the molecular formula C28H33N5O6S2 and a molecular weight of 599.74 g/mol. Its IUPAC name is 4-[[(2S)-2-acetamido-3-methylbutyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[[(2S)-2-acetamido-3-methylbutyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 141238340 |
| Molecular Formula | C28H33N5O6S2 |
| Molecular Weight | 599.74 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | 4-[[(2S)-2-acetamido-3-methylbutyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CC(=O)N[C@H](CNc1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1)C(C)C |
| InChI | InChI=1S/C28H33N5O6S2/c1-19(2)26(31-20(3)34)18-30-22-11-9-21(10-12-22)28(35)32-41(38,39)24-13-14-25(27(17-24)33(36)37)29-15-16-40-23-7-5-4-6-8-23/h4-14,17,19,26,29-30H,15-16,18H2,1-3H3,(H,31,34)(H,32,35)/t26-/m1/s1 |
| InChIKey | AUTPLLWXRJIVFQ-AREMUKBSSA-N |
| XLogP | 4.49 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|