C29H32N4O7S3 — CID 141238335
4-[(2S)-2-acetamido-5-methylsulfanylpentanoyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 141238335) has the molecular formula C29H32N4O7S3 and a molecular weight of 644.80 g/mol. Its IUPAC name is 4-[(2S)-2-acetamido-5-methylsulfanylpentanoyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[(2S)-2-acetamido-5-methylsulfanylpentanoyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 141238335 |
| Molecular Formula | C29H32N4O7S3 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.14 |
| IUPAC Name | 4-[(2S)-2-acetamido-5-methylsulfanylpentanoyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CSCCC[C@H](NC(C)=O)C(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C29H32N4O7S3/c1-20(34)31-26(9-6-17-41-2)28(35)21-10-12-22(13-11-21)29(36)32-43(39,40)24-14-15-25(27(19-24)33(37)38)30-16-18-42-23-7-4-3-5-8-23/h3-5,7-8,10-15,19,26,30H,6,9,16-18H2,1-2H3,(H,31,34)(H,32,36)/t26-/m0/s1 |
| InChIKey | CMWHKBITPMCMIM-SANMLTNESA-N |
| XLogP | 4.75 |
| TPSA | 164.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|