C34H35N5O8S2 — CID 53235094
methyl N-[(2S)-3-methyl-1-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]anilino]-1-oxo-4-phenylbutan-2-yl]carbamate (PubChem CID 53235094) has the molecular formula C34H35N5O8S2 and a molecular weight of 705.82 g/mol. Its IUPAC name is methyl N-[(2S)-3-methyl-1-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]anilino]-1-oxo-4-phenylbutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-3-methyl-1-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]anilino]-1-oxo-4-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 53235094 |
| Molecular Formula | C34H35N5O8S2 |
| Molecular Weight | 705.82 g/mol |
| Exact Mass | 705.19 |
| IUPAC Name | methyl N-[(2S)-3-methyl-1-[4-[[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylcarbamoyl]anilino]-1-oxo-4-phenylbutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)Nc1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C34H35N5O8S2/c1-23(21-24-9-5-3-6-10-24)31(37-34(42)47-2)33(41)36-26-15-13-25(14-16-26)32(40)38-49(45,46)28-17-18-29(30(22-28)39(43)44)35-19-20-48-27-11-7-4-8-12-27/h3-18,22-23,31,35H,19-21H2,1-2H3,(H,36,41)(H,37,42)(H,38,40)/t23?,31-/m0/s1 |
| InChIKey | AKEWVXJHBHURHS-HPTWYVLESA-N |
| XLogP | 5.46 |
| TPSA | 185.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|