C33H36N4O6S2 — CID 11707282
4-[4-[3-(dimethylamino)propyl]-2-methoxyphenyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 11707282) has the molecular formula C33H36N4O6S2 and a molecular weight of 648.81 g/mol. Its IUPAC name is 4-[4-[3-(dimethylamino)propyl]-2-methoxyphenyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[3-(dimethylamino)propyl]-2-methoxyphenyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 11707282 |
| Molecular Formula | C33H36N4O6S2 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.21 |
| IUPAC Name | 4-[4-[3-(dimethylamino)propyl]-2-methoxyphenyl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | COc1cc(CCCN(C)C)ccc1-c1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C33H36N4O6S2/c1-36(2)20-7-8-24-11-17-29(32(22-24)43-3)25-12-14-26(15-13-25)33(38)35-45(41,42)28-16-18-30(31(23-28)37(39)40)34-19-21-44-27-9-5-4-6-10-27/h4-6,9-18,22-23,34H,7-8,19-21H2,1-3H3,(H,35,38) |
| InChIKey | QJXYANOGESSWIK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|