C39H47N5O7S2 — CID 11607405
N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[2-methoxy-4-(3-morpholin-4-ylpropyl)phenyl]benzamide (PubChem CID 11607405) has the molecular formula C39H47N5O7S2 and a molecular weight of 761.97 g/mol. Its IUPAC name is N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[2-methoxy-4-(3-morpholin-4-ylpropyl)phenyl]benzamide.
| Compound Name | N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[2-methoxy-4-(3-morpholin-4-ylpropyl)phenyl]benzamide |
|---|---|
| PubChem CID | 11607405 |
| Molecular Formula | C39H47N5O7S2 |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.29 |
| IUPAC Name | N-[4-[[(2R)-6-amino-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[2-methoxy-4-(3-morpholin-4-ylpropyl)phenyl]benzamide |
| SMILES | COc1cc(CCCN2CCOCC2)ccc1-c1ccc(C(=O)NS(=O)(=O)c2ccc(N[C@H](CCCCN)CSc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C39H47N5O7S2/c1-50-38-26-29(8-7-21-43-22-24-51-25-23-43)12-18-35(38)30-13-15-31(16-14-30)39(45)42-53(48,49)34-17-19-36(37(27-34)44(46)47)41-32(9-5-6-20-40)28-52-33-10-3-2-4-11-33/h2-4,10-19,26-27,32,41H,5-9,20-25,28,40H2,1H3,(H,42,45)/t32-/m1/s1 |
| InChIKey | FKXZASURJKOHMN-JGCGQSQUSA-N |
| XLogP | 6.36 |
| TPSA | 166.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|