C34H45N5O5S2 — CID 11721651
N-[4-[[(2R)-6-(dimethylamino)-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4,4-dimethylpiperidin-1-yl)benzamide (PubChem CID 11721651) has the molecular formula C34H45N5O5S2 and a molecular weight of 667.90 g/mol. Its IUPAC name is N-[4-[[(2R)-6-(dimethylamino)-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4,4-dimethylpiperidin-1-yl)benzamide.
| Compound Name | N-[4-[[(2R)-6-(dimethylamino)-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4,4-dimethylpiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 11721651 |
| Molecular Formula | C34H45N5O5S2 |
| Molecular Weight | 667.90 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | N-[4-[[(2R)-6-(dimethylamino)-1-phenylsulfanylhexan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-(4,4-dimethylpiperidin-1-yl)benzamide |
| SMILES | CN(C)CCCC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCC(C)(C)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H45N5O5S2/c1-34(2)19-22-38(23-20-34)28-15-13-26(14-16-28)33(40)36-46(43,44)30-17-18-31(32(24-30)39(41)42)35-27(10-8-9-21-37(3)4)25-45-29-11-6-5-7-12-29/h5-7,11-18,24,27,35H,8-10,19-23,25H2,1-4H3,(H,36,40)/t27-/m1/s1 |
| InChIKey | DCUPDSTXISCXNY-HHHXNRCGSA-N |
| XLogP | 6.64 |
| TPSA | 124.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.90 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|