C39H48N6O5S3 — CID 67251835
N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-propan-2-ylsulfanylphenyl)methyl]piperazin-1-yl]benzamide (PubChem CID 67251835) has the molecular formula C39H48N6O5S3 and a molecular weight of 777.05 g/mol. Its IUPAC name is N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-propan-2-ylsulfanylphenyl)methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-propan-2-ylsulfanylphenyl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 67251835 |
| Molecular Formula | C39H48N6O5S3 |
| Molecular Weight | 777.05 g/mol |
| Exact Mass | 776.28 |
| IUPAC Name | N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[(2-propan-2-ylsulfanylphenyl)methyl]piperazin-1-yl]benzamide |
| SMILES | CC(C)Sc1ccccc1CN1CCN(c2ccc(C(=O)NS(=O)(=O)c3ccc(N[C@H](CCN(C)C)CSc4ccccc4)c([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C39H48N6O5S3/c1-29(2)52-38-13-9-8-10-31(38)27-43-22-24-44(25-23-43)33-16-14-30(15-17-33)39(46)41-53(49,50)35-18-19-36(37(26-35)45(47)48)40-32(20-21-42(3)4)28-51-34-11-6-5-7-12-34/h5-19,26,29,32,40H,20-25,27-28H2,1-4H3,(H,41,46)/t32-/m1/s1 |
| InChIKey | GMHRNZOPJUSQHA-JGCGQSQUSA-N |
| XLogP | 7.06 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.05 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|