C44H49ClN6O5S2 — CID 77220669
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[4-[methyl(propan-2-yl)amino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 77220669) has the molecular formula C44H49ClN6O5S2 and a molecular weight of 841.50 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[4-[methyl(propan-2-yl)amino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[4-[methyl(propan-2-yl)amino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 77220669 |
| Molecular Formula | C44H49ClN6O5S2 |
| Molecular Weight | 841.50 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[4-[methyl(propan-2-yl)amino]-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CC(C)N(C)CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(Cl)cc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C44H49ClN6O5S2/c1-32(2)48(3)24-23-37(31-57-39-10-5-4-6-11-39)46-42-22-21-40(29-43(42)51(53)54)58(55,56)47-44(52)34-15-19-38(20-16-34)50-27-25-49(26-28-50)30-35-9-7-8-12-41(35)33-13-17-36(45)18-14-33/h4-22,29,32,37,46H,23-28,30-31H2,1-3H3,(H,47,52) |
| InChIKey | WJIVIIWAMTWFBU-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.50 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|