C42H47N7O5S2 — CID 163288307
4-[4-[[2-(4-aminophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 163288307) has the molecular formula C42H47N7O5S2 and a molecular weight of 794.02 g/mol. Its IUPAC name is 4-[4-[[2-(4-aminophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-aminophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 163288307 |
| Molecular Formula | C42H47N7O5S2 |
| Molecular Weight | 794.02 g/mol |
| Exact Mass | 793.31 |
| IUPAC Name | 4-[4-[[2-(4-aminophenyl)phenyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(N)cc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C42H47N7O5S2/c1-46(2)23-22-35(30-55-37-9-4-3-5-10-37)44-40-21-20-38(28-41(40)49(51)52)56(53,54)45-42(50)32-14-18-36(19-15-32)48-26-24-47(25-27-48)29-33-8-6-7-11-39(33)31-12-16-34(43)17-13-31/h3-21,28,35,44H,22-27,29-30,43H2,1-2H3,(H,45,50)/t35-/m1/s1 |
| InChIKey | QOMZIMFVTNBZJE-PGUFJCEWSA-N |
| XLogP | 6.81 |
| TPSA | 154.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.02 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|