C41H44ClN7O5S2 — CID 67069421
4-[4-[[3-(4-chlorophenyl)-4-pyridinyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide (PubChem CID 67069421) has the molecular formula C41H44ClN7O5S2 and a molecular weight of 814.43 g/mol. Its IUPAC name is 4-[4-[[3-(4-chlorophenyl)-4-pyridinyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[3-(4-chlorophenyl)-4-pyridinyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67069421 |
| Molecular Formula | C41H44ClN7O5S2 |
| Molecular Weight | 814.43 g/mol |
| Exact Mass | 813.25 |
| IUPAC Name | 4-[4-[[3-(4-chlorophenyl)-4-pyridinyl]methyl]piperazin-1-yl]-N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonylbenzamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccncc4-c4ccc(Cl)cc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C41H44ClN7O5S2/c1-46(2)21-19-34(29-55-36-6-4-3-5-7-36)44-39-17-16-37(26-40(39)49(51)52)56(53,54)45-41(50)31-10-14-35(15-11-31)48-24-22-47(23-25-48)28-32-18-20-43-27-38(32)30-8-12-33(42)13-9-30/h3-18,20,26-27,34,44H,19,21-25,28-29H2,1-2H3,(H,45,50)/t34-/m1/s1 |
| InChIKey | AOWMWGRHMRLLBL-UUWRZZSWSA-N |
| XLogP | 7.28 |
| TPSA | 141.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.43 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|