C43H48N6O7S3 — CID 52941663
N-[4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(4-methylsulfonylphenyl)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 52941663) has the molecular formula C43H48N6O7S3 and a molecular weight of 857.09 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(4-methylsulfonylphenyl)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(4-methylsulfonylphenyl)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 52941663 |
| Molecular Formula | C43H48N6O7S3 |
| Molecular Weight | 857.09 g/mol |
| Exact Mass | 856.27 |
| IUPAC Name | N-[4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(4-methylsulfonylphenyl)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | CN(C)CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccc(S(C)(=O)=O)cc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C43H48N6O7S3/c1-46(2)24-23-35(31-57-37-10-5-4-6-11-37)44-41-22-21-39(29-42(41)49(51)52)59(55,56)45-43(50)33-13-17-36(18-14-33)48-27-25-47(26-28-48)30-34-9-7-8-12-40(34)32-15-19-38(20-16-32)58(3,53)54/h4-22,29,35,44H,23-28,30-31H2,1-3H3,(H,45,50) |
| InChIKey | FJXGVYVCHDWGPF-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 162.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.09 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|