C42H45FN6O5S2 — CID 54575991
N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-3-fluoro-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide (PubChem CID 54575991) has the molecular formula C42H45FN6O5S2 and a molecular weight of 796.99 g/mol. Its IUPAC name is N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-3-fluoro-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-3-fluoro-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 54575991 |
| Molecular Formula | C42H45FN6O5S2 |
| Molecular Weight | 796.99 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | N-[4-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-3-fluoro-4-[4-[(2-phenylphenyl)methyl]piperazin-1-yl]benzamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(N3CCN(Cc4ccccc4-c4ccccc4)CC3)c(F)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C42H45FN6O5S2/c1-46(2)22-21-34(30-55-35-14-7-4-8-15-35)44-39-19-18-36(28-41(39)49(51)52)56(53,54)45-42(50)32-17-20-40(38(43)27-32)48-25-23-47(24-26-48)29-33-13-9-10-16-37(33)31-11-5-3-6-12-31/h3-20,27-28,34,44H,21-26,29-30H2,1-2H3,(H,45,50)/t34-/m1/s1 |
| InChIKey | UQZHAQATWBSHTI-UUWRZZSWSA-N |
| XLogP | 7.37 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.99 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|