C45H49ClN6O5S2 — CID 67069667
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[(2R)-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl]amino]phenyl]sulfonylbenzamide (PubChem CID 67069667) has the molecular formula C45H49ClN6O5S2 and a molecular weight of 853.51 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[(2R)-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl]amino]phenyl]sulfonylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[(2R)-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl]amino]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 67069667 |
| Molecular Formula | C45H49ClN6O5S2 |
| Molecular Weight | 853.51 g/mol |
| Exact Mass | 852.29 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-[3-nitro-4-[[(2R)-1-phenylsulfanyl-4-piperidin-1-ylbutan-2-yl]amino]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(N[C@H](CCN2CCCCC2)CSc2ccccc2)c([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C45H49ClN6O5S2/c46-37-17-13-34(14-18-37)42-12-6-5-9-36(42)32-50-27-29-51(30-28-50)39-19-15-35(16-20-39)45(53)48-59(56,57)41-21-22-43(44(31-41)52(54)55)47-38(23-26-49-24-7-2-8-25-49)33-58-40-10-3-1-4-11-40/h1,3-6,9-22,31,38,47H,2,7-8,23-30,32-33H2,(H,48,53)/t38-/m1/s1 |
| InChIKey | YMCWUYYKPGMGCT-KXQOOQHDSA-N |
| XLogP | 8.80 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.51 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|