C39H49N7O5S2 — CID 142684004
N-[2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]benzamide (PubChem CID 142684004) has the molecular formula C39H49N7O5S2 and a molecular weight of 760.00 g/mol. Its IUPAC name is N-[2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]benzamide.
| Compound Name | N-[2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 142684004 |
| Molecular Formula | C39H49N7O5S2 |
| Molecular Weight | 760.00 g/mol |
| Exact Mass | 759.32 |
| IUPAC Name | N-[2-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrophenyl]sulfonyl-4-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]benzamide |
| SMILES | CC(C)Nc1ccccc1CN1CCN(c2ccc(C(=O)NS(=O)(=O)c3cccc([N+](=O)[O-])c3N[C@H](CCN(C)C)CSc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C39H49N7O5S2/c1-29(2)40-35-14-9-8-11-31(35)27-44-23-25-45(26-24-44)33-19-17-30(18-20-33)39(47)42-53(50,51)37-16-10-15-36(46(48)49)38(37)41-32(21-22-43(3)4)28-52-34-12-6-5-7-13-34/h5-20,29,32,40-41H,21-28H2,1-4H3,(H,42,47)/t32-/m1/s1 |
| InChIKey | CSOVOIHYDYLSSW-JGCGQSQUSA-N |
| XLogP | 6.38 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.00 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|