C42H46N6O5S3 — CID 46842952
N-[5-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-4-nitrothiophen-2-yl]sulfonyl-4-[4-(3,3-diphenylprop-2-enyl)piperazin-1-yl]benzamide (PubChem CID 46842952) has the molecular formula C42H46N6O5S3 and a molecular weight of 811.07 g/mol. Its IUPAC name is N-[5-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-4-nitrothiophen-2-yl]sulfonyl-4-[4-(3,3-diphenylprop-2-enyl)piperazin-1-yl]benzamide.
| Compound Name | N-[5-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-4-nitrothiophen-2-yl]sulfonyl-4-[4-(3,3-diphenylprop-2-enyl)piperazin-1-yl]benzamide |
|---|---|
| PubChem CID | 46842952 |
| Molecular Formula | C42H46N6O5S3 |
| Molecular Weight | 811.07 g/mol |
| Exact Mass | 810.27 |
| IUPAC Name | N-[5-[[(2R)-4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-4-nitrothiophen-2-yl]sulfonyl-4-[4-(3,3-diphenylprop-2-enyl)piperazin-1-yl]benzamide |
| SMILES | CN(C)CC[C@H](CSc1ccccc1)Nc1sc(S(=O)(=O)NC(=O)c2ccc(N3CCN(CC=C(c4ccccc4)c4ccccc4)CC3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C42H46N6O5S3/c1-45(2)24-22-35(31-54-37-16-10-5-11-17-37)43-42-39(48(50)51)30-40(55-42)56(52,53)44-41(49)34-18-20-36(21-19-34)47-28-26-46(27-29-47)25-23-38(32-12-6-3-7-13-32)33-14-8-4-9-15-33/h3-21,23,30,35,43H,22,24-29,31H2,1-2H3,(H,44,49)/t35-/m1/s1 |
| InChIKey | QLOVRKDYNJCKSX-PGUFJCEWSA-N |
| XLogP | 7.55 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.07 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|