C40H49N9O4S2 — CID 66909739
4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide (PubChem CID 66909739) has the molecular formula C40H49N9O4S2 and a molecular weight of 784.03 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide.
| Compound Name | 4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 66909739 |
| Molecular Formula | C40H49N9O4S2 |
| Molecular Weight | 784.03 g/mol |
| Exact Mass | 783.33 |
| IUPAC Name | 4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitro-N-[7-[4-[[2-(propan-2-ylamino)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]benzenesulfonamide |
| SMILES | CC(C)Nc1ccccc1CN1CCN(c2ccc3c(NS(=O)(=O)c4ccc(NC(CCN(C)C)CSc5ccccc5)c([N+](=O)[O-])c4)ncnc3c2)CC1 |
| InChI | InChI=1S/C40H49N9O4S2/c1-29(2)43-36-13-9-8-10-30(36)26-47-20-22-48(23-21-47)32-14-16-35-38(24-32)41-28-42-40(35)45-55(52,53)34-15-17-37(39(25-34)49(50)51)44-31(18-19-46(3)4)27-54-33-11-6-5-7-12-33/h5-17,24-25,28-29,31,43-44H,18-23,26-27H2,1-4H3,(H,41,42,45) |
| InChIKey | SYRQHGGWUWUKLR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 148.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.03 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|