C47H53ClN8O4S2 — CID 67119054
N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dipropylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 67119054) has the molecular formula C47H53ClN8O4S2 and a molecular weight of 893.58 g/mol. Its IUPAC name is N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dipropylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dipropylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67119054 |
| Molecular Formula | C47H53ClN8O4S2 |
| Molecular Weight | 893.58 g/mol |
| Exact Mass | 892.33 |
| IUPAC Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dipropylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CCCN(CCC)CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C47H53ClN8O4S2/c1-3-23-53(24-4-2)25-22-38(33-61-40-11-6-5-7-12-40)51-44-21-19-41(31-46(44)56(57)58)62(59,60)52-47-43-20-18-39(30-45(43)49-34-50-47)55-28-26-54(27-29-55)32-36-10-8-9-13-42(36)35-14-16-37(48)17-15-35/h5-21,30-31,34,38,51H,3-4,22-29,32-33H2,1-2H3,(H,49,50,52) |
| InChIKey | ZELJOAHZBWMPMO-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.58 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|