C45H49ClN8O4S2 — CID 67119078
N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(diethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 67119078) has the molecular formula C45H49ClN8O4S2 and a molecular weight of 865.53 g/mol. Its IUPAC name is N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(diethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(diethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67119078 |
| Molecular Formula | C45H49ClN8O4S2 |
| Molecular Weight | 865.53 g/mol |
| Exact Mass | 864.30 |
| IUPAC Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(diethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C45H49ClN8O4S2/c1-3-51(4-2)23-22-36(31-59-38-11-6-5-7-12-38)49-42-21-19-39(29-44(42)54(55)56)60(57,58)50-45-41-20-18-37(28-43(41)47-32-48-45)53-26-24-52(25-27-53)30-34-10-8-9-13-40(34)33-14-16-35(46)17-15-33/h5-21,28-29,32,36,49H,3-4,22-27,30-31H2,1-2H3,(H,47,48,50) |
| InChIKey | WUWNFZXMBSIVQB-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.53 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|