C43H45ClN8O4S2 — CID 66909370
N-[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 66909370) has the molecular formula C43H45ClN8O4S2 and a molecular weight of 837.47 g/mol. Its IUPAC name is N-[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66909370 |
| Molecular Formula | C43H45ClN8O4S2 |
| Molecular Weight | 837.47 g/mol |
| Exact Mass | 836.27 |
| IUPAC Name | N-[7-[4-[(5-chloro-2-phenylphenyl)methyl]piperazin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5cc(Cl)ccc5-c5ccccc5)CC4)ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C43H45ClN8O4S2/c1-49(2)20-19-34(29-57-36-11-7-4-8-12-36)47-40-18-15-37(27-42(40)52(53)54)58(55,56)48-43-39-17-14-35(26-41(39)45-30-46-43)51-23-21-50(22-24-51)28-32-25-33(44)13-16-38(32)31-9-5-3-6-10-31/h3-18,25-27,30,34,47H,19-24,28-29H2,1-2H3,(H,45,46,48) |
| InChIKey | WTQLEMWPWNSIIK-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.47 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|