C44H45ClN8O5S2 — CID 67118741
N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrobenzenesulfonamide (PubChem CID 67118741) has the molecular formula C44H45ClN8O5S2 and a molecular weight of 865.48 g/mol. Its IUPAC name is N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67118741 |
| Molecular Formula | C44H45ClN8O5S2 |
| Molecular Weight | 865.48 g/mol |
| Exact Mass | 864.26 |
| IUPAC Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]quinazolin-4-yl]-4-[(1-morpholin-4-yl-3-phenylsulfanylpropan-2-yl)amino]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCN(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)ccc1NC(CSc1ccccc1)CN1CCOCC1 |
| InChI | InChI=1S/C44H45ClN8O5S2/c45-34-12-10-32(11-13-34)39-9-5-4-6-33(39)28-50-18-20-52(21-19-50)36-14-16-40-42(26-36)46-31-47-44(40)49-60(56,57)38-15-17-41(43(27-38)53(54)55)48-35(29-51-22-24-58-25-23-51)30-59-37-7-2-1-3-8-37/h1-17,26-27,31,35,48H,18-25,28-30H2,(H,46,47,49) |
| InChIKey | MFPNRJJQYSCKND-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.48 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|