C46H48ClN7O5S2 — CID 67118767
N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitrobenzenesulfonamide (PubChem CID 67118767) has the molecular formula C46H48ClN7O5S2 and a molecular weight of 878.52 g/mol. Its IUPAC name is N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 67118767 |
| Molecular Formula | C46H48ClN7O5S2 |
| Molecular Weight | 878.52 g/mol |
| Exact Mass | 877.28 |
| IUPAC Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[(4-morpholin-4-yl-1-phenylsulfanylbutan-2-yl)amino]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2ncnc3cc(N4CCC(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)ccc1NC(CCN1CCOCC1)CSc1ccccc1 |
| InChI | InChI=1S/C46H48ClN7O5S2/c47-36-12-10-34(11-13-36)41-9-5-4-6-35(41)28-33-18-22-53(23-19-33)38-14-16-42-44(29-38)48-32-49-46(42)51-61(57,58)40-15-17-43(45(30-40)54(55)56)50-37(20-21-52-24-26-59-27-25-52)31-60-39-7-2-1-3-8-39/h1-17,29-30,32-33,37,50H,18-28,31H2,(H,48,49,51) |
| InChIKey | CRLSORRPTRXGMP-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 142.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 878.52 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|