C44H46ClN7O4S2 — CID 66909763
N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 66909763) has the molecular formula C44H46ClN7O4S2 and a molecular weight of 836.48 g/mol. Its IUPAC name is N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 66909763 |
| Molecular Formula | C44H46ClN7O4S2 |
| Molecular Weight | 836.48 g/mol |
| Exact Mass | 835.27 |
| IUPAC Name | N-[7-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperidin-1-yl]quinazolin-4-yl]-4-[[4-(dimethylamino)-1-phenylsulfanylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | CN(C)CCC(CSc1ccccc1)Nc1ccc(S(=O)(=O)Nc2ncnc3cc(N4CCC(Cc5ccccc5-c5ccc(Cl)cc5)CC4)ccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C44H46ClN7O4S2/c1-50(2)23-22-35(29-57-37-9-4-3-5-10-37)48-41-19-17-38(28-43(41)52(53)54)58(55,56)49-44-40-18-16-36(27-42(40)46-30-47-44)51-24-20-31(21-25-51)26-33-8-6-7-11-39(33)32-12-14-34(45)15-13-32/h3-19,27-28,30-31,35,48H,20-26,29H2,1-2H3,(H,46,47,49) |
| InChIKey | ZXUFRBHLKSBHKF-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 133.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.48 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|